About 2-(4-cyclohexylcyclohexyl)-7-(trifluoromethoxy)-3,4-dihydro-2H-chromene;rubidium(1+)
2-(4-cyclohexylcyclohexyl)-7-(trifluoromethoxy)-3,4-dihydro-2H-chromene;rubidium(1+) (PubChem CID 59795424) has the molecular formula C22H28F3O2Rb
and a molecular weight of 466.93 g/mol. Its IUPAC name is 2-(4-cyclohexylcyclohexyl)-7-(trifluoromethoxy)-3,4-dihydro-2H-chromene;rubidium(1+).
Molecular Properties
| Compound Name | 2-(4-cyclohexylcyclohexyl)-7-(trifluoromethoxy)-3,4-dihydro-2H-chromene;rubidium(1+) |
| PubChem CID | 59795424 |
| Molecular Formula | C22H28F3O2Rb |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 2-(4-cyclohexylcyclohexyl)-7-(trifluoromethoxy)-3,4-dihydro-2H-chromene;rubidium(1+) |
| SMILES | FC(F)(F)Oc1ccc2c(c1)OC(C1CCC(C3CC[CH-]CC3)CC1)CC2.[Rb+] |
| InChI | InChI=1S/C22H28F3O2.Rb/c23-22(24,25)27-19-12-10-18-11-13-20(26-21(18)14-19)17-8-6-16(7-9-17)15-4-2-1-3-5-15;/h1,10,12,14-17,20H,2-9,11,13H2;/q-1;+1 |
| InChIKey | VQRRCCCRCILOLV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-cyclohexylcyclohexyl)-7-(trifluoromethoxy)-3,4-dihydro-2H-chromene;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyclohexylcyclohexyl)-7-(trifluoromethoxy)-3,4-dihydro-2H-chromene;rubidium(1+)?
The IUPAC name of 2-(4-cyclohexylcyclohexyl)-7-(trifluoromethoxy)-3,4-dihydro-2H-chromene;rubidium(1+) (CID 59795424) is 2-(4-cyclohexylcyclohexyl)-7-(trifluoromethoxy)-3,4-dihydro-2H-chromene;rubidium(1+).
What is the SMILES notation for 2-(4-cyclohexylcyclohexyl)-7-(trifluoromethoxy)-3,4-dihydro-2H-chromene;rubidium(1+)?
The canonical SMILES for 2-(4-cyclohexylcyclohexyl)-7-(trifluoromethoxy)-3,4-dihydro-2H-chromene;rubidium(1+) is FC(F)(F)Oc1ccc2c(c1)OC(C1CCC(C3CC[CH-]CC3)CC1)CC2.[Rb+].
What is the InChIKey of 2-(4-cyclohexylcyclohexyl)-7-(trifluoromethoxy)-3,4-dihydro-2H-chromene;rubidium(1+)?
The InChIKey is VQRRCCCRCILOLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28F3O2.Rb/c23-22(24,25)27-19-12-10-18-11-13-20(26-21(18)14-19)17-8-6-16(7-9-17)15-4-2-1-3-5-15;/h1,10,12,14-17,20H,2-9,11,13H2;/q-1;+1.
What are the key properties of 2-(4-cyclohexylcyclohexyl)-7-(trifluoromethoxy)-3,4-dihydro-2H-chromene;rubidium(1+)?
2-(4-cyclohexylcyclohexyl)-7-(trifluoromethoxy)-3,4-dihydro-2H-chromene;rubidium(1+) has a molecular weight of 466.93 g/mol, XLogP of 3.48, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyclohexylcyclohexyl)-7-(trifluoromethoxy)-3,4-dihydro-2H-chromene;rubidium(1+) is sourced from PubChem (CID 59795424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).