About 1-(fluoromethoxy)-3,7-dimethylnaphthalene
1-(fluoromethoxy)-3,7-dimethylnaphthalene (PubChem CID 59795441) has the molecular formula C13H13FO
and a molecular weight of 204.24 g/mol. Its IUPAC name is 1-(fluoromethoxy)-3,7-dimethylnaphthalene.
Molecular Properties
| Compound Name | 1-(fluoromethoxy)-3,7-dimethylnaphthalene |
| PubChem CID | 59795441 |
| Molecular Formula | C13H13FO |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 1-(fluoromethoxy)-3,7-dimethylnaphthalene |
| SMILES | Cc1cc(OCF)c2cc(C)ccc2c1 |
| InChI | InChI=1S/C13H13FO/c1-9-3-4-11-5-10(2)7-13(15-8-14)12(11)6-9/h3-7H,8H2,1-2H3 |
| InChIKey | FRAAKHCRQITCGL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(fluoromethoxy)-3,7-dimethylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(fluoromethoxy)-3,7-dimethylnaphthalene?
The IUPAC name of 1-(fluoromethoxy)-3,7-dimethylnaphthalene (CID 59795441) is 1-(fluoromethoxy)-3,7-dimethylnaphthalene.
What is the SMILES notation for 1-(fluoromethoxy)-3,7-dimethylnaphthalene?
The canonical SMILES for 1-(fluoromethoxy)-3,7-dimethylnaphthalene is Cc1cc(OCF)c2cc(C)ccc2c1.
What is the InChIKey of 1-(fluoromethoxy)-3,7-dimethylnaphthalene?
The InChIKey is FRAAKHCRQITCGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FO/c1-9-3-4-11-5-10(2)7-13(15-8-14)12(11)6-9/h3-7H,8H2,1-2H3.
What are the key properties of 1-(fluoromethoxy)-3,7-dimethylnaphthalene?
1-(fluoromethoxy)-3,7-dimethylnaphthalene has a molecular weight of 204.24 g/mol, XLogP of 3.76, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(fluoromethoxy)-3,7-dimethylnaphthalene is sourced from PubChem (CID 59795441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).