About 7-(difluoromethyl)-2-propyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-chromene
7-(difluoromethyl)-2-propyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-chromene (PubChem CID 59795448) has the molecular formula C20H19F5O2
and a molecular weight of 386.36 g/mol. Its IUPAC name is 7-(difluoromethyl)-2-propyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 7-(difluoromethyl)-2-propyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-chromene |
| PubChem CID | 59795448 |
| Molecular Formula | C20H19F5O2 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 7-(difluoromethyl)-2-propyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-chromene |
| SMILES | CCCC1CCc2cc(-c3ccc(OC(F)(F)F)cc3)c(C(F)F)cc2O1 |
| InChI | InChI=1S/C20H19F5O2/c1-2-3-14-7-6-13-10-16(17(19(21)22)11-18(13)26-14)12-4-8-15(9-5-12)27-20(23,24)25/h4-5,8-11,14,19H,2-3,6-7H2,1H3 |
| InChIKey | DETYQDVEBUYUJV-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(difluoromethyl)-2-propyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(difluoromethyl)-2-propyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-chromene?
The IUPAC name of 7-(difluoromethyl)-2-propyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-chromene (CID 59795448) is 7-(difluoromethyl)-2-propyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-chromene.
What is the SMILES notation for 7-(difluoromethyl)-2-propyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-chromene?
The canonical SMILES for 7-(difluoromethyl)-2-propyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-chromene is CCCC1CCc2cc(-c3ccc(OC(F)(F)F)cc3)c(C(F)F)cc2O1.
What is the InChIKey of 7-(difluoromethyl)-2-propyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-chromene?
The InChIKey is DETYQDVEBUYUJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F5O2/c1-2-3-14-7-6-13-10-16(17(19(21)22)11-18(13)26-14)12-4-8-15(9-5-12)27-20(23,24)25/h4-5,8-11,14,19H,2-3,6-7H2,1H3.
What are the key properties of 7-(difluoromethyl)-2-propyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-chromene?
7-(difluoromethyl)-2-propyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-chromene has a molecular weight of 386.36 g/mol, XLogP of 6.68, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(difluoromethyl)-2-propyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-chromene is sourced from PubChem (CID 59795448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).