C20H14N+ — CID 59795578
9-phenyl-1-azoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8,10,12-heptaene (PubChem CID 59795578) has the molecular formula C20H14N+ and a molecular weight of 268.34 g/mol. Its IUPAC name is 9-phenyl-1-azoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8,10,12-heptaene.
| Compound Name | 9-phenyl-1-azoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8,10,12-heptaene |
|---|---|
| PubChem CID | 59795578 |
| Molecular Formula | C20H14N+ |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 9-phenyl-1-azoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8,10,12-heptaene |
| SMILES | c1ccc(-c2ccc3c4c2ccc2ccc[n+](c24)C3)cc1 |
| InChI | InChI=1S/C20H14N/c1-2-5-14(6-3-1)17-10-9-16-13-21-12-4-7-15-8-11-18(17)19(16)20(15)21/h1-12H,13H2/q+1 |
| InChIKey | FNEVXUNCLDKGDC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|