C11H22O5Si — CID 59795609
(3S,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydroxyoxolan-2-one (PubChem CID 59795609) has the molecular formula C11H22O5Si and a molecular weight of 262.38 g/mol. Its IUPAC name is (3S,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydroxyoxolan-2-one.
| Compound Name | (3S,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydroxyoxolan-2-one |
|---|---|
| PubChem CID | 59795609 |
| Molecular Formula | C11H22O5Si |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (3S,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydroxyoxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1OC(=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H22O5Si/c1-11(2,3)17(4,5)15-6-7-8(12)9(13)10(14)16-7/h7-9,12-13H,6H2,1-5H3/t7-,8-,9-/m0/s1 |
| InChIKey | VEYHFQXUICKQJA-CIUDSAMLSA-N |
| XLogP | 0.66 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|