C8H17NO3 — CID 59795677
(2R,3S,4S,5S)-5-methoxy-1,2-dimethylpiperidine-3,4-diol (PubChem CID 59795677) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is (2R,3S,4S,5S)-5-methoxy-1,2-dimethylpiperidine-3,4-diol.
| Compound Name | (2R,3S,4S,5S)-5-methoxy-1,2-dimethylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 59795677 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | (2R,3S,4S,5S)-5-methoxy-1,2-dimethylpiperidine-3,4-diol |
| SMILES | CO[C@H]1CN(C)[C@H](C)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H17NO3/c1-5-7(10)8(11)6(12-3)4-9(5)2/h5-8,10-11H,4H2,1-3H3/t5-,6+,7+,8-/m1/s1 |
| InChIKey | QAMQODOJOSYNKL-VGRMVHKJSA-N |
| XLogP | -0.94 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |