About 3-iodo-5-isocyano-2H-pyrazolo[3,4-c]pyridine
3-iodo-5-isocyano-2H-pyrazolo[3,4-c]pyridine (PubChem CID 59796935) has the molecular formula C7H3IN4
and a molecular weight of 270.03 g/mol. Its IUPAC name is 3-iodo-5-isocyano-2H-pyrazolo[3,4-c]pyridine.
Molecular Properties
| Compound Name | 3-iodo-5-isocyano-2H-pyrazolo[3,4-c]pyridine |
| PubChem CID | 59796935 |
| Molecular Formula | C7H3IN4 |
| Molecular Weight | 270.03 g/mol |
| Exact Mass | 269.94 |
| IUPAC Name | 3-iodo-5-isocyano-2H-pyrazolo[3,4-c]pyridine |
| SMILES | [C-]#[N+]c1cc2c(I)[nH]nc2cn1 |
| InChI | InChI=1S/C7H3IN4/c1-9-6-2-4-5(3-10-6)11-12-7(4)8/h2-3H,(H,11,12) |
| InChIKey | WJCKVBMVRZSXDZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 45.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.03 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-5-isocyano-2H-pyrazolo[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-5-isocyano-2H-pyrazolo[3,4-c]pyridine?
The IUPAC name of 3-iodo-5-isocyano-2H-pyrazolo[3,4-c]pyridine (CID 59796935) is 3-iodo-5-isocyano-2H-pyrazolo[3,4-c]pyridine.
What is the SMILES notation for 3-iodo-5-isocyano-2H-pyrazolo[3,4-c]pyridine?
The canonical SMILES for 3-iodo-5-isocyano-2H-pyrazolo[3,4-c]pyridine is [C-]#[N+]c1cc2c(I)[nH]nc2cn1.
What is the InChIKey of 3-iodo-5-isocyano-2H-pyrazolo[3,4-c]pyridine?
The InChIKey is WJCKVBMVRZSXDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3IN4/c1-9-6-2-4-5(3-10-6)11-12-7(4)8/h2-3H,(H,11,12).
What are the key properties of 3-iodo-5-isocyano-2H-pyrazolo[3,4-c]pyridine?
3-iodo-5-isocyano-2H-pyrazolo[3,4-c]pyridine has a molecular weight of 270.03 g/mol, XLogP of 2.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-5-isocyano-2H-pyrazolo[3,4-c]pyridine is sourced from PubChem (CID 59796935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).