C17H13FN2O3 — CID 59797243
3-[(E)-2-(4-fluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid (PubChem CID 59797243) has the molecular formula C17H13FN2O3 and a molecular weight of 312.30 g/mol. Its IUPAC name is 3-[(E)-2-(4-fluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid.
| Compound Name | 3-[(E)-2-(4-fluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid |
|---|---|
| PubChem CID | 59797243 |
| Molecular Formula | C17H13FN2O3 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 3-[(E)-2-(4-fluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid |
| SMILES | COc1c(C(=O)O)ccc2[nH]nc(/C=C/c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C17H13FN2O3/c1-23-16-12(17(21)22)7-9-14-15(16)13(19-20-14)8-4-10-2-5-11(18)6-3-10/h2-9H,1H3,(H,19,20)(H,21,22)/b8-4+ |
| InChIKey | UGSNJOMKZUJHHT-XBXARRHUSA-N |
| XLogP | 3.58 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |