About 1-methyl-3-methylidene-1,2-dihydroindene
1-methyl-3-methylidene-1,2-dihydroindene (PubChem CID 59797400) has the molecular formula C11H12
and a molecular weight of 144.22 g/mol. Its IUPAC name is 1-methyl-3-methylidene-1,2-dihydroindene.
Molecular Properties
| Compound Name | 1-methyl-3-methylidene-1,2-dihydroindene |
| PubChem CID | 59797400 |
| Molecular Formula | C11H12 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 1-methyl-3-methylidene-1,2-dihydroindene |
| SMILES | C=C1CC(C)c2ccccc21 |
| InChI | InChI=1S/C11H12/c1-8-7-9(2)11-6-4-3-5-10(8)11/h3-6,9H,1,7H2,2H3 |
| InChIKey | UAUOPNZITHPQPR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methyl-3-methylidene-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-methylidene-1,2-dihydroindene?
The IUPAC name of 1-methyl-3-methylidene-1,2-dihydroindene (CID 59797400) is 1-methyl-3-methylidene-1,2-dihydroindene.
What is the SMILES notation for 1-methyl-3-methylidene-1,2-dihydroindene?
The canonical SMILES for 1-methyl-3-methylidene-1,2-dihydroindene is C=C1CC(C)c2ccccc21.
What is the InChIKey of 1-methyl-3-methylidene-1,2-dihydroindene?
The InChIKey is UAUOPNZITHPQPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12/c1-8-7-9(2)11-6-4-3-5-10(8)11/h3-6,9H,1,7H2,2H3.
What are the key properties of 1-methyl-3-methylidene-1,2-dihydroindene?
1-methyl-3-methylidene-1,2-dihydroindene has a molecular weight of 144.22 g/mol, XLogP of 3.21, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-methylidene-1,2-dihydroindene is sourced from PubChem (CID 59797400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).