C21H22F2N4O3S — CID 59797538
5-[4-(2,3-difluorophenoxy)-2-methylanilino]-N'-(1-methoxypropan-2-yl)-3-oxo-1,2-thiazole-4-carboximidamide (PubChem CID 59797538) has the molecular formula C21H22F2N4O3S and a molecular weight of 448.50 g/mol. Its IUPAC name is 5-[4-(2,3-difluorophenoxy)-2-methylanilino]-N'-(1-methoxypropan-2-yl)-3-oxo-1,2-thiazole-4-carboximidamide.
| Compound Name | 5-[4-(2,3-difluorophenoxy)-2-methylanilino]-N'-(1-methoxypropan-2-yl)-3-oxo-1,2-thiazole-4-carboximidamide |
|---|---|
| PubChem CID | 59797538 |
| Molecular Formula | C21H22F2N4O3S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 5-[4-(2,3-difluorophenoxy)-2-methylanilino]-N'-(1-methoxypropan-2-yl)-3-oxo-1,2-thiazole-4-carboximidamide |
| SMILES | COCC(C)/N=C(\N)c1c(Nc2ccc(Oc3cccc(F)c3F)cc2C)s[nH]c1=O |
| InChI | InChI=1S/C21H22F2N4O3S/c1-11-9-13(30-16-6-4-5-14(22)18(16)23)7-8-15(11)26-21-17(20(28)27-31-21)19(24)25-12(2)10-29-3/h4-9,12,26H,10H2,1-3H3,(H2,24,25)(H,27,28) |
| InChIKey | AKTCCGJAMJLZCF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|