C18H17FN4O4S — CID 59797570
N'-(2,2-dihydroxyethyl)-5-[4-(4-fluorophenoxy)anilino]-3-oxo-1,2-thiazole-4-carboximidamide (PubChem CID 59797570) has the molecular formula C18H17FN4O4S and a molecular weight of 404.42 g/mol. Its IUPAC name is N'-(2,2-dihydroxyethyl)-5-[4-(4-fluorophenoxy)anilino]-3-oxo-1,2-thiazole-4-carboximidamide.
| Compound Name | N'-(2,2-dihydroxyethyl)-5-[4-(4-fluorophenoxy)anilino]-3-oxo-1,2-thiazole-4-carboximidamide |
|---|---|
| PubChem CID | 59797570 |
| Molecular Formula | C18H17FN4O4S |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N'-(2,2-dihydroxyethyl)-5-[4-(4-fluorophenoxy)anilino]-3-oxo-1,2-thiazole-4-carboximidamide |
| SMILES | N/C(=N\CC(O)O)c1c(Nc2ccc(Oc3ccc(F)cc3)cc2)s[nH]c1=O |
| InChI | InChI=1S/C18H17FN4O4S/c19-10-1-5-12(6-2-10)27-13-7-3-11(4-8-13)22-18-15(17(26)23-28-18)16(20)21-9-14(24)25/h1-8,14,22,24-25H,9H2,(H2,20,21)(H,23,26) |
| InChIKey | SZXYZSCKUCFXSY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|