About N-butan-2-ylethanimine;yttrium
N-butan-2-ylethanimine;yttrium (PubChem CID 59797811) has the molecular formula C6H11NY-2
and a molecular weight of 186.07 g/mol. Its IUPAC name is N-butan-2-ylethanimine;yttrium.
Molecular Properties
| Compound Name | N-butan-2-ylethanimine;yttrium |
| PubChem CID | 59797811 |
| Molecular Formula | C6H11NY-2 |
| Molecular Weight | 186.07 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | N-butan-2-ylethanimine;yttrium |
| SMILES | C/[C-]=N/C(C)[CH-]C.[Y] |
| InChI | InChI=1S/C6H11N.Y/c1-4-6(3)7-5-2;/h4,6H,1-3H3;/q-2; |
| InChIKey | KDKRUNPZGKFMBD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.07 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-ylethanimine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-ylethanimine;yttrium?
The IUPAC name of N-butan-2-ylethanimine;yttrium (CID 59797811) is N-butan-2-ylethanimine;yttrium.
What is the SMILES notation for N-butan-2-ylethanimine;yttrium?
The canonical SMILES for N-butan-2-ylethanimine;yttrium is C/[C-]=N/C(C)[CH-]C.[Y].
What is the InChIKey of N-butan-2-ylethanimine;yttrium?
The InChIKey is KDKRUNPZGKFMBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N.Y/c1-4-6(3)7-5-2;/h4,6H,1-3H3;/q-2;.
What are the key properties of N-butan-2-ylethanimine;yttrium?
N-butan-2-ylethanimine;yttrium has a molecular weight of 186.07 g/mol, XLogP of 1.56, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-ylethanimine;yttrium is sourced from PubChem (CID 59797811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).