C21H21F3N4O3S — CID 59798179
N'-(1-hydroxypropan-2-yl)-5-[3-methyl-4-[4-(trifluoromethyl)phenoxy]anilino]-3-oxo-1,2-thiazole-4-carboximidamide (PubChem CID 59798179) has the molecular formula C21H21F3N4O3S and a molecular weight of 466.49 g/mol. Its IUPAC name is N'-(1-hydroxypropan-2-yl)-5-[3-methyl-4-[4-(trifluoromethyl)phenoxy]anilino]-3-oxo-1,2-thiazole-4-carboximidamide.
| Compound Name | N'-(1-hydroxypropan-2-yl)-5-[3-methyl-4-[4-(trifluoromethyl)phenoxy]anilino]-3-oxo-1,2-thiazole-4-carboximidamide |
|---|---|
| PubChem CID | 59798179 |
| Molecular Formula | C21H21F3N4O3S |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | N'-(1-hydroxypropan-2-yl)-5-[3-methyl-4-[4-(trifluoromethyl)phenoxy]anilino]-3-oxo-1,2-thiazole-4-carboximidamide |
| SMILES | Cc1cc(Nc2s[nH]c(=O)c2/C(N)=N/C(C)CO)ccc1Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H21F3N4O3S/c1-11-9-14(27-20-17(19(30)28-32-20)18(25)26-12(2)10-29)5-8-16(11)31-15-6-3-13(4-7-15)21(22,23)24/h3-9,12,27,29H,10H2,1-2H3,(H2,25,26)(H,28,30) |
| InChIKey | POFYGTGURDPJSZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|