C27H36N3+3 — CID 59798489
1-[[1,3,5-trimethyl-3,5-bis(pyridin-1-ium-1-ylmethyl)cyclohexyl]methyl]pyridin-1-ium (PubChem CID 59798489) has the molecular formula C27H36N3+3 and a molecular weight of 402.61 g/mol. Its IUPAC name is 1-[[1,3,5-trimethyl-3,5-bis(pyridin-1-ium-1-ylmethyl)cyclohexyl]methyl]pyridin-1-ium.
| Compound Name | 1-[[1,3,5-trimethyl-3,5-bis(pyridin-1-ium-1-ylmethyl)cyclohexyl]methyl]pyridin-1-ium |
|---|---|
| PubChem CID | 59798489 |
| Molecular Formula | C27H36N3+3 |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | 1-[[1,3,5-trimethyl-3,5-bis(pyridin-1-ium-1-ylmethyl)cyclohexyl]methyl]pyridin-1-ium |
| SMILES | CC1(C[n+]2ccccc2)CC(C)(C[n+]2ccccc2)CC(C)(C[n+]2ccccc2)C1 |
| InChI | InChI=1S/C27H36N3/c1-25(22-28-13-7-4-8-14-28)19-26(2,23-29-15-9-5-10-16-29)21-27(3,20-25)24-30-17-11-6-12-18-30/h4-18H,19-24H2,1-3H3/q+3 |
| InChIKey | QWTDQSDRIIACMV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 11.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|