About 1,1,3-triphenylurea
1,1,3-triphenylurea (PubChem CID 597994) has the molecular formula C19H16N2O
and a molecular weight of 288.35 g/mol. Its IUPAC name is 1,1,3-triphenylurea.
Molecular Properties
| Compound Name | 1,1,3-triphenylurea |
| PubChem CID | 597994 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1,1,3-triphenylurea |
| SMILES | O=C(Nc1ccccc1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16N2O/c22-19(20-16-10-4-1-5-11-16)21(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H,(H,20,22) |
| InChIKey | HKQGDIKHDDGEOE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1,3-triphenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3-triphenylurea?
The IUPAC name of 1,1,3-triphenylurea (CID 597994) is 1,1,3-triphenylurea.
What is the SMILES notation for 1,1,3-triphenylurea?
The canonical SMILES for 1,1,3-triphenylurea is O=C(Nc1ccccc1)N(c1ccccc1)c1ccccc1.
What is the InChIKey of 1,1,3-triphenylurea?
The InChIKey is HKQGDIKHDDGEOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O/c22-19(20-16-10-4-1-5-11-16)21(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H,(H,20,22).
What are the key properties of 1,1,3-triphenylurea?
1,1,3-triphenylurea has a molecular weight of 288.35 g/mol, XLogP of 5.06, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3-triphenylurea is sourced from PubChem (CID 597994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).