C9H10FNO — CID 59799575
(4S)-8-fluoro-3,4-dihydro-1H-isochromen-4-amine (PubChem CID 59799575) has the molecular formula C9H10FNO and a molecular weight of 167.18 g/mol. Its IUPAC name is (4S)-8-fluoro-3,4-dihydro-1H-isochromen-4-amine.
| Compound Name | (4S)-8-fluoro-3,4-dihydro-1H-isochromen-4-amine |
|---|---|
| PubChem CID | 59799575 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | (4S)-8-fluoro-3,4-dihydro-1H-isochromen-4-amine |
| SMILES | N[C@@H]1COCc2c(F)cccc21 |
| InChI | InChI=1S/C9H10FNO/c10-8-3-1-2-6-7(8)4-12-5-9(6)11/h1-3,9H,4-5,11H2/t9-/m1/s1 |
| InChIKey | XRCYXCKAPZNPRD-SECBINFHSA-N |
| XLogP | 1.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |