About tert-butyl 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylate
tert-butyl 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylate (PubChem CID 59799788) has the molecular formula C22H32N4O3
and a molecular weight of 400.52 g/mol. Its IUPAC name is tert-butyl 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylate |
| PubChem CID | 59799788 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | tert-butyl 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Nc2ccc3c(cnn3C(=O)C(C)(C)C)c2)C1 |
| InChI | InChI=1S/C22H32N4O3/c1-21(2,3)19(27)26-18-10-9-16(12-15(18)13-23-26)24-17-8-7-11-25(14-17)20(28)29-22(4,5)6/h9-10,12-13,17,24H,7-8,11,14H2,1-6H3 |
| InChIKey | QZYMUVXXWJRFPK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylate (CID 59799788) is tert-butyl 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCCC(Nc2ccc3c(cnn3C(=O)C(C)(C)C)c2)C1.
What is the InChIKey of tert-butyl 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylate?
The InChIKey is QZYMUVXXWJRFPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32N4O3/c1-21(2,3)19(27)26-18-10-9-16(12-15(18)13-23-26)24-17-8-7-11-25(14-17)20(28)29-22(4,5)6/h9-10,12-13,17,24H,7-8,11,14H2,1-6H3.
What are the key properties of tert-butyl 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylate?
tert-butyl 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylate has a molecular weight of 400.52 g/mol, XLogP of 4.53, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[[1-(2,2-dimethylpropanoyl)indazol-5-yl]amino]piperidine-1-carboxylate is sourced from PubChem (CID 59799788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).