C26H48 — CID 59800044
trans-(1R,2R)-1-tert-butyl-2-(2,2-dimethylpropyl)-1,2,3,3,5,5-hexamethyl-4,4-bis(prop-1-en-2-yl)cyclopentane (PubChem CID 59800044) has the molecular formula C26H48 and a molecular weight of 360.67 g/mol. Its IUPAC name is trans-(1R,2R)-1-tert-butyl-2-(2,2-dimethylpropyl)-1,2,3,3,5,5-hexamethyl-4,4-bis(prop-1-en-2-yl)cyclopentane.
| Compound Name | trans-(1R,2R)-1-tert-butyl-2-(2,2-dimethylpropyl)-1,2,3,3,5,5-hexamethyl-4,4-bis(prop-1-en-2-yl)cyclopentane |
|---|---|
| PubChem CID | 59800044 |
| Molecular Formula | C26H48 |
| Molecular Weight | 360.67 g/mol |
| Exact Mass | 360.38 |
| IUPAC Name | trans-(1R,2R)-1-tert-butyl-2-(2,2-dimethylpropyl)-1,2,3,3,5,5-hexamethyl-4,4-bis(prop-1-en-2-yl)cyclopentane |
| SMILES | C=C(C)C1(C(=C)C)C(C)(C)[C@@](C)(C(C)(C)C)[C@](C)(CC(C)(C)C)C1(C)C |
| InChI | InChI=1S/C26H48/c1-18(2)26(19(3)4)22(11,12)24(15,17-20(5,6)7)25(16,21(8,9)10)23(26,13)14/h1,3,17H2,2,4-16H3/t24-,25-/m1/s1 |
| InChIKey | VVGKATHNYKTKDV-JWQCQUIFSA-N |
| XLogP | 8.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.67 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|