About benzyl (3R,4S)-4-acetyl-1-(2,2-difluoroethyl)pyrrolidine-3-carboxylate
benzyl (3R,4S)-4-acetyl-1-(2,2-difluoroethyl)pyrrolidine-3-carboxylate (PubChem CID 59800177) has the molecular formula C16H19F2NO3
and a molecular weight of 311.33 g/mol. Its IUPAC name is benzyl (3R,4S)-4-acetyl-1-(2,2-difluoroethyl)pyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | benzyl (3R,4S)-4-acetyl-1-(2,2-difluoroethyl)pyrrolidine-3-carboxylate |
| PubChem CID | 59800177 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | benzyl (3R,4S)-4-acetyl-1-(2,2-difluoroethyl)pyrrolidine-3-carboxylate |
| SMILES | CC(=O)[C@@H]1CN(CC(F)F)C[C@@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H19F2NO3/c1-11(20)13-7-19(9-15(17)18)8-14(13)16(21)22-10-12-5-3-2-4-6-12/h2-6,13-15H,7-10H2,1H3/t13-,14-/m0/s1 |
| InChIKey | YWUKUMDSJGEAAB-KBPBESRZSA-N |
| XLogP | 2.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl (3R,4S)-4-acetyl-1-(2,2-difluoroethyl)pyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (3R,4S)-4-acetyl-1-(2,2-difluoroethyl)pyrrolidine-3-carboxylate?
The IUPAC name of benzyl (3R,4S)-4-acetyl-1-(2,2-difluoroethyl)pyrrolidine-3-carboxylate (CID 59800177) is benzyl (3R,4S)-4-acetyl-1-(2,2-difluoroethyl)pyrrolidine-3-carboxylate.
What is the SMILES notation for benzyl (3R,4S)-4-acetyl-1-(2,2-difluoroethyl)pyrrolidine-3-carboxylate?
The canonical SMILES for benzyl (3R,4S)-4-acetyl-1-(2,2-difluoroethyl)pyrrolidine-3-carboxylate is CC(=O)[C@@H]1CN(CC(F)F)C[C@@H]1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl (3R,4S)-4-acetyl-1-(2,2-difluoroethyl)pyrrolidine-3-carboxylate?
The InChIKey is YWUKUMDSJGEAAB-KBPBESRZSA-N. The full InChI is InChI=1S/C16H19F2NO3/c1-11(20)13-7-19(9-15(17)18)8-14(13)16(21)22-10-12-5-3-2-4-6-12/h2-6,13-15H,7-10H2,1H3/t13-,14-/m0/s1.
What are the key properties of benzyl (3R,4S)-4-acetyl-1-(2,2-difluoroethyl)pyrrolidine-3-carboxylate?
benzyl (3R,4S)-4-acetyl-1-(2,2-difluoroethyl)pyrrolidine-3-carboxylate has a molecular weight of 311.33 g/mol, XLogP of 2.13, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (3R,4S)-4-acetyl-1-(2,2-difluoroethyl)pyrrolidine-3-carboxylate is sourced from PubChem (CID 59800177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).