About 3-chlorobenzo[b][1]benzoxepine-5,6-dicarboxylic acid
3-chlorobenzo[b][1]benzoxepine-5,6-dicarboxylic acid (PubChem CID 59800201) has the molecular formula C16H9ClO5
and a molecular weight of 316.70 g/mol. Its IUPAC name is 3-chlorobenzo[b][1]benzoxepine-5,6-dicarboxylic acid.
Molecular Properties
| Compound Name | 3-chlorobenzo[b][1]benzoxepine-5,6-dicarboxylic acid |
| PubChem CID | 59800201 |
| Molecular Formula | C16H9ClO5 |
| Molecular Weight | 316.70 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 3-chlorobenzo[b][1]benzoxepine-5,6-dicarboxylic acid |
| SMILES | O=C(O)C1=C(C(=O)O)c2cc(Cl)ccc2Oc2ccccc21 |
| InChI | InChI=1S/C16H9ClO5/c17-8-5-6-12-10(7-8)14(16(20)21)13(15(18)19)9-3-1-2-4-11(9)22-12/h1-7H,(H,18,19)(H,20,21) |
| InChIKey | VVTJGGAFLLEIRT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.70 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorobenzo[b][1]benzoxepine-5,6-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobenzo[b][1]benzoxepine-5,6-dicarboxylic acid?
The IUPAC name of 3-chlorobenzo[b][1]benzoxepine-5,6-dicarboxylic acid (CID 59800201) is 3-chlorobenzo[b][1]benzoxepine-5,6-dicarboxylic acid.
What is the SMILES notation for 3-chlorobenzo[b][1]benzoxepine-5,6-dicarboxylic acid?
The canonical SMILES for 3-chlorobenzo[b][1]benzoxepine-5,6-dicarboxylic acid is O=C(O)C1=C(C(=O)O)c2cc(Cl)ccc2Oc2ccccc21.
What is the InChIKey of 3-chlorobenzo[b][1]benzoxepine-5,6-dicarboxylic acid?
The InChIKey is VVTJGGAFLLEIRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9ClO5/c17-8-5-6-12-10(7-8)14(16(20)21)13(15(18)19)9-3-1-2-4-11(9)22-12/h1-7H,(H,18,19)(H,20,21).
What are the key properties of 3-chlorobenzo[b][1]benzoxepine-5,6-dicarboxylic acid?
3-chlorobenzo[b][1]benzoxepine-5,6-dicarboxylic acid has a molecular weight of 316.70 g/mol, XLogP of 3.53, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobenzo[b][1]benzoxepine-5,6-dicarboxylic acid is sourced from PubChem (CID 59800201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).