About CID 59800207
CID 59800207 (PubChem CID 59800207) has the molecular formula C5H11NOSi
and a molecular weight of 129.23 g/mol.
Molecular Properties
| Compound Name | CID 59800207 |
| PubChem CID | 59800207 |
| Molecular Formula | C5H11NOSi |
| Molecular Weight | 129.23 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | — |
| SMILES | C[Si]N1CC[C@H](O)C1 |
| InChI | InChI=1S/C5H11NOSi/c1-8-6-3-2-5(7)4-6/h5,7H,2-4H2,1H3/t5-/m0/s1 |
| InChIKey | MTBNVGJDIONBMQ-YFKPBYRVSA-N |
| XLogP | -0.28 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.23 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59800207 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59800207?
The IUPAC name of CID 59800207 (CID 59800207) is not available.
What is the SMILES notation for CID 59800207?
The canonical SMILES for CID 59800207 is C[Si]N1CC[C@H](O)C1.
What is the InChIKey of CID 59800207?
The InChIKey is MTBNVGJDIONBMQ-YFKPBYRVSA-N. The full InChI is InChI=1S/C5H11NOSi/c1-8-6-3-2-5(7)4-6/h5,7H,2-4H2,1H3/t5-/m0/s1.
What are the key properties of CID 59800207?
CID 59800207 has a molecular weight of 129.23 g/mol, XLogP of -0.28, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59800207 is sourced from PubChem (CID 59800207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).