C24H17F3IrN6-2 — CID 59800443
1-benzyl-4-phenylimidazole;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine (PubChem CID 59800443) has the molecular formula C24H17F3IrN6-2 and a molecular weight of 638.65 g/mol. Its IUPAC name is 1-benzyl-4-phenylimidazole;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine.
| Compound Name | 1-benzyl-4-phenylimidazole;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine |
|---|---|
| PubChem CID | 59800443 |
| Molecular Formula | C24H17F3IrN6-2 |
| Molecular Weight | 638.65 g/mol |
| Exact Mass | 639.11 |
| IUPAC Name | 1-benzyl-4-phenylimidazole;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine |
| SMILES | FC(F)(F)c1n[n-]c(-c2ccccn2)n1.[Ir].[c-]1ccccc1-c1cn(Cc2ccccc2)cn1 |
| InChI | InChI=1S/C16H13N2.C8H4F3N4.Ir/c1-3-7-14(8-4-1)11-18-12-16(17-13-18)15-9-5-2-6-10-15;9-8(10,11)7-13-6(14-15-7)5-3-1-2-4-12-5;/h1-9,12-13H,11H2;1-4H;/q2*-1; |
| InChIKey | GTAZDHKKPCTWPB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 70.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.65 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|