About 3-chloro-2,6-diethyl-5-nitroaniline
3-chloro-2,6-diethyl-5-nitroaniline (PubChem CID 59800724) has the molecular formula C10H13ClN2O2
and a molecular weight of 228.68 g/mol. Its IUPAC name is 3-chloro-2,6-diethyl-5-nitroaniline.
Molecular Properties
| Compound Name | 3-chloro-2,6-diethyl-5-nitroaniline |
| PubChem CID | 59800724 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 3-chloro-2,6-diethyl-5-nitroaniline |
| SMILES | CCc1c(Cl)cc([N+](=O)[O-])c(CC)c1N |
| InChI | InChI=1S/C10H13ClN2O2/c1-3-6-8(11)5-9(13(14)15)7(4-2)10(6)12/h5H,3-4,12H2,1-2H3 |
| InChIKey | BDIKUMQCWBVORN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,6-diethyl-5-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,6-diethyl-5-nitroaniline?
The IUPAC name of 3-chloro-2,6-diethyl-5-nitroaniline (CID 59800724) is 3-chloro-2,6-diethyl-5-nitroaniline.
What is the SMILES notation for 3-chloro-2,6-diethyl-5-nitroaniline?
The canonical SMILES for 3-chloro-2,6-diethyl-5-nitroaniline is CCc1c(Cl)cc([N+](=O)[O-])c(CC)c1N.
What is the InChIKey of 3-chloro-2,6-diethyl-5-nitroaniline?
The InChIKey is BDIKUMQCWBVORN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN2O2/c1-3-6-8(11)5-9(13(14)15)7(4-2)10(6)12/h5H,3-4,12H2,1-2H3.
What are the key properties of 3-chloro-2,6-diethyl-5-nitroaniline?
3-chloro-2,6-diethyl-5-nitroaniline has a molecular weight of 228.68 g/mol, XLogP of 2.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,6-diethyl-5-nitroaniline is sourced from PubChem (CID 59800724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).