About 3-(3-amino-5-chloro-2,6-diethylphenyl)-1-(cyclohexylmethyl)-1-(4-propan-2-ylphenyl)urea
3-(3-amino-5-chloro-2,6-diethylphenyl)-1-(cyclohexylmethyl)-1-(4-propan-2-ylphenyl)urea (PubChem CID 59800748) has the molecular formula C27H38ClN3O
and a molecular weight of 456.07 g/mol. Its IUPAC name is 3-(3-amino-5-chloro-2,6-diethylphenyl)-1-(cyclohexylmethyl)-1-(4-propan-2-ylphenyl)urea.
Molecular Properties
| Compound Name | 3-(3-amino-5-chloro-2,6-diethylphenyl)-1-(cyclohexylmethyl)-1-(4-propan-2-ylphenyl)urea |
| PubChem CID | 59800748 |
| Molecular Formula | C27H38ClN3O |
| Molecular Weight | 456.07 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | 3-(3-amino-5-chloro-2,6-diethylphenyl)-1-(cyclohexylmethyl)-1-(4-propan-2-ylphenyl)urea |
| SMILES | CCc1c(N)cc(Cl)c(CC)c1NC(=O)N(CC1CCCCC1)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C27H38ClN3O/c1-5-22-24(28)16-25(29)23(6-2)26(22)30-27(32)31(17-19-10-8-7-9-11-19)21-14-12-20(13-15-21)18(3)4/h12-16,18-19H,5-11,17,29H2,1-4H3,(H,30,32) |
| InChIKey | RMIGASGHGWHYGE-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.07 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-amino-5-chloro-2,6-diethylphenyl)-1-(cyclohexylmethyl)-1-(4-propan-2-ylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-amino-5-chloro-2,6-diethylphenyl)-1-(cyclohexylmethyl)-1-(4-propan-2-ylphenyl)urea?
The IUPAC name of 3-(3-amino-5-chloro-2,6-diethylphenyl)-1-(cyclohexylmethyl)-1-(4-propan-2-ylphenyl)urea (CID 59800748) is 3-(3-amino-5-chloro-2,6-diethylphenyl)-1-(cyclohexylmethyl)-1-(4-propan-2-ylphenyl)urea.
What is the SMILES notation for 3-(3-amino-5-chloro-2,6-diethylphenyl)-1-(cyclohexylmethyl)-1-(4-propan-2-ylphenyl)urea?
The canonical SMILES for 3-(3-amino-5-chloro-2,6-diethylphenyl)-1-(cyclohexylmethyl)-1-(4-propan-2-ylphenyl)urea is CCc1c(N)cc(Cl)c(CC)c1NC(=O)N(CC1CCCCC1)c1ccc(C(C)C)cc1.
What is the InChIKey of 3-(3-amino-5-chloro-2,6-diethylphenyl)-1-(cyclohexylmethyl)-1-(4-propan-2-ylphenyl)urea?
The InChIKey is RMIGASGHGWHYGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H38ClN3O/c1-5-22-24(28)16-25(29)23(6-2)26(22)30-27(32)31(17-19-10-8-7-9-11-19)21-14-12-20(13-15-21)18(3)4/h12-16,18-19H,5-11,17,29H2,1-4H3,(H,30,32).
What are the key properties of 3-(3-amino-5-chloro-2,6-diethylphenyl)-1-(cyclohexylmethyl)-1-(4-propan-2-ylphenyl)urea?
3-(3-amino-5-chloro-2,6-diethylphenyl)-1-(cyclohexylmethyl)-1-(4-propan-2-ylphenyl)urea has a molecular weight of 456.07 g/mol, XLogP of 7.79, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-amino-5-chloro-2,6-diethylphenyl)-1-(cyclohexylmethyl)-1-(4-propan-2-ylphenyl)urea is sourced from PubChem (CID 59800748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).