C25H29ClN4O — CID 59800771
3-(3-amino-5-chloro-2,6-diethylphenyl)-1-benzyl-1-[4-(methylamino)phenyl]urea (PubChem CID 59800771) has the molecular formula C25H29ClN4O and a molecular weight of 436.99 g/mol. Its IUPAC name is 3-(3-amino-5-chloro-2,6-diethylphenyl)-1-benzyl-1-[4-(methylamino)phenyl]urea.
| Compound Name | 3-(3-amino-5-chloro-2,6-diethylphenyl)-1-benzyl-1-[4-(methylamino)phenyl]urea |
|---|---|
| PubChem CID | 59800771 |
| Molecular Formula | C25H29ClN4O |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 3-(3-amino-5-chloro-2,6-diethylphenyl)-1-benzyl-1-[4-(methylamino)phenyl]urea |
| SMILES | CCc1c(N)cc(Cl)c(CC)c1NC(=O)N(Cc1ccccc1)c1ccc(NC)cc1 |
| InChI | InChI=1S/C25H29ClN4O/c1-4-20-22(26)15-23(27)21(5-2)24(20)29-25(31)30(16-17-9-7-6-8-10-17)19-13-11-18(28-3)12-14-19/h6-15,28H,4-5,16,27H2,1-3H3,(H,29,31) |
| InChIKey | JNVBXKATMLFNEK-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|