C30H21NO — CID 59800933
4-[3-[3-(3-pyridin-2-ylphenyl)phenyl]phenyl]benzaldehyde (PubChem CID 59800933) has the molecular formula C30H21NO and a molecular weight of 411.50 g/mol. Its IUPAC name is 4-[3-[3-(3-pyridin-2-ylphenyl)phenyl]phenyl]benzaldehyde.
| Compound Name | 4-[3-[3-(3-pyridin-2-ylphenyl)phenyl]phenyl]benzaldehyde |
|---|---|
| PubChem CID | 59800933 |
| Molecular Formula | C30H21NO |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-[3-[3-(3-pyridin-2-ylphenyl)phenyl]phenyl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2cccc(-c3cccc(-c4cccc(-c5ccccn5)c4)c3)c2)cc1 |
| InChI | InChI=1S/C30H21NO/c32-21-22-13-15-23(16-14-22)24-6-3-7-25(18-24)26-8-4-9-27(19-26)28-10-5-11-29(20-28)30-12-1-2-17-31-30/h1-21H |
| InChIKey | BRLDXGAXTQTHPM-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|