C49H45NS — CID 59801103
3,3,11,11-tetramethyl-7-[[6-[(E)-2-[6-(5-phenylthiophen-2-yl)naphthalen-2-yl]ethenyl]naphthalen-2-yl]methyl]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene (PubChem CID 59801103) has the molecular formula C49H45NS and a molecular weight of 679.97 g/mol. Its IUPAC name is 3,3,11,11-tetramethyl-7-[[6-[(E)-2-[6-(5-phenylthiophen-2-yl)naphthalen-2-yl]ethenyl]naphthalen-2-yl]methyl]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene.
| Compound Name | 3,3,11,11-tetramethyl-7-[[6-[(E)-2-[6-(5-phenylthiophen-2-yl)naphthalen-2-yl]ethenyl]naphthalen-2-yl]methyl]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene |
|---|---|
| PubChem CID | 59801103 |
| Molecular Formula | C49H45NS |
| Molecular Weight | 679.97 g/mol |
| Exact Mass | 679.33 |
| IUPAC Name | 3,3,11,11-tetramethyl-7-[[6-[(E)-2-[6-(5-phenylthiophen-2-yl)naphthalen-2-yl]ethenyl]naphthalen-2-yl]methyl]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene |
| SMILES | CC1(C)Cc2cc(Cc3ccc4cc(/C=C/c5ccc6cc(-c7ccc(-c8ccccc8)s7)ccc6c5)ccc4c3)cc3c2N(C1)CC(C)(C)C3 |
| InChI | InChI=1S/C49H45NS/c1-48(2)29-43-26-36(27-44-30-49(3,4)32-50(31-48)47(43)44)22-35-14-17-38-23-33(12-15-39(38)25-35)10-11-34-13-16-41-28-42(19-18-40(41)24-34)46-21-20-45(51-46)37-8-6-5-7-9-37/h5-21,23-28H,22,29-32H2,1-4H3/b11-10+ |
| InChIKey | RRUWEXIOGJJTFY-ZHACJKMWSA-N |
| XLogP | 13.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.97 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|