C29H40F3NO5S — CID 59801371
[(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylidene]amino] 2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 59801371) has the molecular formula C29H40F3NO5S and a molecular weight of 571.70 g/mol. Its IUPAC name is [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylidene]amino] 2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylidene]amino] 2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 59801371 |
| Molecular Formula | C29H40F3NO5S |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylidene]amino] 2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | CCC(C)(C)C(OO)c1ccc(/C(=N\OS(=O)(=O)c2c(C(C)C)cc(C(C)C)cc2C(C)C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H40F3NO5S/c1-10-28(8,9)27(37-34)21-13-11-20(12-14-21)26(29(30,31)32)33-38-39(35,36)25-23(18(4)5)15-22(17(2)3)16-24(25)19(6)7/h11-19,27,34H,10H2,1-9H3/b33-26+ |
| InChIKey | QAFGVBMZWJJYGY-MHTZHOPKSA-N |
| XLogP | 8.70 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|