C19H18F5NO5S — CID 59801377
[(Z)-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylideneamino] 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 59801377) has the molecular formula C19H18F5NO5S and a molecular weight of 467.41 g/mol. Its IUPAC name is [(Z)-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylideneamino] 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | [(Z)-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylideneamino] 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 59801377 |
| Molecular Formula | C19H18F5NO5S |
| Molecular Weight | 467.41 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | [(Z)-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylideneamino] 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | CCC(C)C(OO)c1ccc(/C(C)=N\OS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C19H18F5NO5S/c1-4-9(2)18(29-26)12-7-5-11(6-8-12)10(3)25-30-31(27,28)19-16(23)14(21)13(20)15(22)17(19)24/h5-9,18,26H,4H2,1-3H3/b25-10- |
| InChIKey | LUNXQYTWOXVAAV-MRUKODCESA-N |
| XLogP | 5.09 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|