C22H23F6NO5S — CID 59801382
[(Z)-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] 3,5-bis(trifluoromethyl)benzenesulfonate (PubChem CID 59801382) has the molecular formula C22H23F6NO5S and a molecular weight of 527.48 g/mol. Its IUPAC name is [(Z)-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] 3,5-bis(trifluoromethyl)benzenesulfonate.
| Compound Name | [(Z)-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] 3,5-bis(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 59801382 |
| Molecular Formula | C22H23F6NO5S |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | [(Z)-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] 3,5-bis(trifluoromethyl)benzenesulfonate |
| SMILES | CCC(C)(C)C(OO)c1ccc(/C(C)=N\OS(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H23F6NO5S/c1-5-20(3,4)19(33-30)15-8-6-14(7-9-15)13(2)29-34-35(31,32)18-11-16(21(23,24)25)10-17(12-18)22(26,27)28/h6-12,19,30H,5H2,1-4H3/b29-13- |
| InChIKey | YEZSVNUZOSJWAN-DBFSUHOCSA-N |
| XLogP | 6.82 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|