C20H20F5NO5S — CID 59801391
[(Z)-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 59801391) has the molecular formula C20H20F5NO5S and a molecular weight of 481.44 g/mol. Its IUPAC name is [(Z)-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | [(Z)-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 59801391 |
| Molecular Formula | C20H20F5NO5S |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | [(Z)-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylideneamino] 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | CCC(C)(C)C(OO)c1ccc(/C(C)=N\OS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C20H20F5NO5S/c1-5-20(3,4)19(30-27)12-8-6-11(7-9-12)10(2)26-31-32(28,29)18-16(24)14(22)13(21)15(23)17(18)25/h6-9,19,27H,5H2,1-4H3/b26-10- |
| InChIKey | HPPCXMRMKOTORF-KALUYTGESA-N |
| XLogP | 5.48 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|