C23H28F3NO5S — CID 59801392
[(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylidene]amino] 2,4,6-trimethylbenzenesulfonate (PubChem CID 59801392) has the molecular formula C23H28F3NO5S and a molecular weight of 487.54 g/mol. Its IUPAC name is [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylidene]amino] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylidene]amino] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 59801392 |
| Molecular Formula | C23H28F3NO5S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]ethylidene]amino] 2,4,6-trimethylbenzenesulfonate |
| SMILES | CCC(C)(C)C(OO)c1ccc(/C(=N\OS(=O)(=O)c2c(C)cc(C)cc2C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H28F3NO5S/c1-7-22(5,6)21(31-28)18-10-8-17(9-11-18)20(23(24,25)26)27-32-33(29,30)19-15(3)12-14(2)13-16(19)4/h8-13,21,28H,7H2,1-6H3/b27-20+ |
| InChIKey | ZNZYPGUECDGTPO-NHFJDJAPSA-N |
| XLogP | 6.25 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|