C19H15F8NO5S — CID 59801402
[(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylidene]amino] 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 59801402) has the molecular formula C19H15F8NO5S and a molecular weight of 521.38 g/mol. Its IUPAC name is [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylidene]amino] 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylidene]amino] 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 59801402 |
| Molecular Formula | C19H15F8NO5S |
| Molecular Weight | 521.38 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylidene]amino] 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | CCC(C)C(OO)c1ccc(/C(=N\OS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F8NO5S/c1-3-8(2)16(32-29)9-4-6-10(7-5-9)18(19(25,26)27)28-33-34(30,31)17-14(23)12(21)11(20)13(22)15(17)24/h4-8,16,29H,3H2,1-2H3/b28-18+ |
| InChIKey | JFLUWBIUSNQYKY-MTDXEUNCSA-N |
| XLogP | 5.63 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.38 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|