C22H26F3NO5S — CID 59801404
[(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylidene]amino] 2,4,6-trimethylbenzenesulfonate (PubChem CID 59801404) has the molecular formula C22H26F3NO5S and a molecular weight of 473.51 g/mol. Its IUPAC name is [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylidene]amino] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylidene]amino] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 59801404 |
| Molecular Formula | C22H26F3NO5S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | [(E)-[2,2,2-trifluoro-1-[4-(1-hydroperoxy-2-methylbutyl)phenyl]ethylidene]amino] 2,4,6-trimethylbenzenesulfonate |
| SMILES | CCC(C)C(OO)c1ccc(/C(=N\OS(=O)(=O)c2c(C)cc(C)cc2C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H26F3NO5S/c1-6-14(3)19(30-27)17-7-9-18(10-8-17)21(22(23,24)25)26-31-32(28,29)20-15(4)11-13(2)12-16(20)5/h7-12,14,19,27H,6H2,1-5H3/b26-21+ |
| InChIKey | NAEAMRQJVSQUGL-YYADALCUSA-N |
| XLogP | 5.86 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|