C29H23FN8O6 — CID 59801908
7-N-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]-4-fluorophenyl]methyl]-4-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-5H-pyrrolo[3,2-d]pyrimidine-4,7-dicarboxamide (PubChem CID 59801908) has the molecular formula C29H23FN8O6 and a molecular weight of 598.55 g/mol. Its IUPAC name is 7-N-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]-4-fluorophenyl]methyl]-4-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-5H-pyrrolo[3,2-d]pyrimidine-4,7-dicarboxamide.
| Compound Name | 7-N-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]-4-fluorophenyl]methyl]-4-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-5H-pyrrolo[3,2-d]pyrimidine-4,7-dicarboxamide |
|---|---|
| PubChem CID | 59801908 |
| Molecular Formula | C29H23FN8O6 |
| Molecular Weight | 598.55 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | 7-N-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]-4-fluorophenyl]methyl]-4-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-5H-pyrrolo[3,2-d]pyrimidine-4,7-dicarboxamide |
| SMILES | Nc1c(NCc2cc(CNC(=O)c3c[nH]c4c(C(=O)NCc5ccc6c(c5)NC(=O)CO6)ncnc34)ccc2F)c(=O)c1=O |
| InChI | InChI=1S/C29H23FN8O6/c30-17-3-1-13(5-15(17)9-32-23-21(31)26(40)27(23)41)7-34-28(42)16-10-33-24-22(16)36-12-37-25(24)29(43)35-8-14-2-4-19-18(6-14)38-20(39)11-44-19/h1-6,10,12,32-33H,7-9,11,31H2,(H,34,42)(H,35,43)(H,38,39) |
| InChIKey | MGKQXHNPMGFCKL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 210.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.55 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|