C30H25FN8O6 — CID 59802033
7-N-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)-methylamino]methyl]-4-fluorophenyl]methyl]-4-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-5H-pyrrolo[3,2-d]pyrimidine-4,7-dicarboxamide (PubChem CID 59802033) has the molecular formula C30H25FN8O6 and a molecular weight of 612.58 g/mol. Its IUPAC name is 7-N-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)-methylamino]methyl]-4-fluorophenyl]methyl]-4-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-5H-pyrrolo[3,2-d]pyrimidine-4,7-dicarboxamide.
| Compound Name | 7-N-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)-methylamino]methyl]-4-fluorophenyl]methyl]-4-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-5H-pyrrolo[3,2-d]pyrimidine-4,7-dicarboxamide |
|---|---|
| PubChem CID | 59802033 |
| Molecular Formula | C30H25FN8O6 |
| Molecular Weight | 612.58 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | 7-N-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)-methylamino]methyl]-4-fluorophenyl]methyl]-4-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-5H-pyrrolo[3,2-d]pyrimidine-4,7-dicarboxamide |
| SMILES | CN(Cc1cc(CNC(=O)c2c[nH]c3c(C(=O)NCc4ccc5c(c4)NC(=O)CO5)ncnc23)ccc1F)c1c(N)c(=O)c1=O |
| InChI | InChI=1S/C30H25FN8O6/c1-39(26-22(32)27(41)28(26)42)11-16-6-14(2-4-18(16)31)8-34-29(43)17-10-33-24-23(17)36-13-37-25(24)30(44)35-9-15-3-5-20-19(7-15)38-21(40)12-45-20/h2-7,10,13,33H,8-9,11-12,32H2,1H3,(H,34,43)(H,35,44)(H,38,40) |
| InChIKey | SVAPONGDWLFEIN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 201.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.58 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|