About 3-methyl-4H-pyridin-4-ide-2,6-diamine;yttrium
3-methyl-4H-pyridin-4-ide-2,6-diamine;yttrium (PubChem CID 59802451) has the molecular formula C6H8N3Y-
and a molecular weight of 211.06 g/mol. Its IUPAC name is 3-methyl-4H-pyridin-4-ide-2,6-diamine;yttrium.
Molecular Properties
| Compound Name | 3-methyl-4H-pyridin-4-ide-2,6-diamine;yttrium |
| PubChem CID | 59802451 |
| Molecular Formula | C6H8N3Y- |
| Molecular Weight | 211.06 g/mol |
| Exact Mass | 210.98 |
| IUPAC Name | 3-methyl-4H-pyridin-4-ide-2,6-diamine;yttrium |
| SMILES | Cc1[c-]cc(N)nc1N.[Y] |
| InChI | InChI=1S/C6H8N3.Y/c1-4-2-3-5(7)9-6(4)8;/h3H,1H3,(H4,7,8,9);/q-1; |
| InChIKey | VKLBRKIVFZCWOW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.06 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4H-pyridin-4-ide-2,6-diamine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4H-pyridin-4-ide-2,6-diamine;yttrium?
The IUPAC name of 3-methyl-4H-pyridin-4-ide-2,6-diamine;yttrium (CID 59802451) is 3-methyl-4H-pyridin-4-ide-2,6-diamine;yttrium.
What is the SMILES notation for 3-methyl-4H-pyridin-4-ide-2,6-diamine;yttrium?
The canonical SMILES for 3-methyl-4H-pyridin-4-ide-2,6-diamine;yttrium is Cc1[c-]cc(N)nc1N.[Y].
What is the InChIKey of 3-methyl-4H-pyridin-4-ide-2,6-diamine;yttrium?
The InChIKey is VKLBRKIVFZCWOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N3.Y/c1-4-2-3-5(7)9-6(4)8;/h3H,1H3,(H4,7,8,9);/q-1;.
What are the key properties of 3-methyl-4H-pyridin-4-ide-2,6-diamine;yttrium?
3-methyl-4H-pyridin-4-ide-2,6-diamine;yttrium has a molecular weight of 211.06 g/mol, XLogP of 0.35, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4H-pyridin-4-ide-2,6-diamine;yttrium is sourced from PubChem (CID 59802451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).