C22H17N7O7S — CID 59802526
7-[(3-nitrophenyl)sulfonylamino]-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-5H-pyrrolo[3,2-d]pyrimidine-4-carboxamide (PubChem CID 59802526) has the molecular formula C22H17N7O7S and a molecular weight of 523.49 g/mol. Its IUPAC name is 7-[(3-nitrophenyl)sulfonylamino]-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-5H-pyrrolo[3,2-d]pyrimidine-4-carboxamide.
| Compound Name | 7-[(3-nitrophenyl)sulfonylamino]-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-5H-pyrrolo[3,2-d]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 59802526 |
| Molecular Formula | C22H17N7O7S |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | 7-[(3-nitrophenyl)sulfonylamino]-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-5H-pyrrolo[3,2-d]pyrimidine-4-carboxamide |
| SMILES | O=C1COc2ccc(CNC(=O)c3ncnc4c(NS(=O)(=O)c5cccc([N+](=O)[O-])c5)c[nH]c34)cc2N1 |
| InChI | InChI=1S/C22H17N7O7S/c30-18-10-36-17-5-4-12(6-15(17)27-18)8-24-22(31)21-20-19(25-11-26-21)16(9-23-20)28-37(34,35)14-3-1-2-13(7-14)29(32)33/h1-7,9,11,23,28H,8,10H2,(H,24,31)(H,27,30) |
| InChIKey | BPJRBWRQUKPCFO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 198.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|