About 1-tert-butyl-4-methylidene-3-propan-2-yl-1,3,5-triazin-2-one
1-tert-butyl-4-methylidene-3-propan-2-yl-1,3,5-triazin-2-one (PubChem CID 59802858) has the molecular formula C11H19N3O
and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-tert-butyl-4-methylidene-3-propan-2-yl-1,3,5-triazin-2-one.
Molecular Properties
| Compound Name | 1-tert-butyl-4-methylidene-3-propan-2-yl-1,3,5-triazin-2-one |
| PubChem CID | 59802858 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1-tert-butyl-4-methylidene-3-propan-2-yl-1,3,5-triazin-2-one |
| SMILES | C=C1N=CN(C(C)(C)C)C(=O)N1C(C)C |
| InChI | InChI=1S/C11H19N3O/c1-8(2)14-9(3)12-7-13(10(14)15)11(4,5)6/h7-8H,3H2,1-2,4-6H3 |
| InChIKey | ZKINZPJDRKQLPF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-4-methylidene-3-propan-2-yl-1,3,5-triazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-methylidene-3-propan-2-yl-1,3,5-triazin-2-one?
The IUPAC name of 1-tert-butyl-4-methylidene-3-propan-2-yl-1,3,5-triazin-2-one (CID 59802858) is 1-tert-butyl-4-methylidene-3-propan-2-yl-1,3,5-triazin-2-one.
What is the SMILES notation for 1-tert-butyl-4-methylidene-3-propan-2-yl-1,3,5-triazin-2-one?
The canonical SMILES for 1-tert-butyl-4-methylidene-3-propan-2-yl-1,3,5-triazin-2-one is C=C1N=CN(C(C)(C)C)C(=O)N1C(C)C.
What is the InChIKey of 1-tert-butyl-4-methylidene-3-propan-2-yl-1,3,5-triazin-2-one?
The InChIKey is ZKINZPJDRKQLPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O/c1-8(2)14-9(3)12-7-13(10(14)15)11(4,5)6/h7-8H,3H2,1-2,4-6H3.
What are the key properties of 1-tert-butyl-4-methylidene-3-propan-2-yl-1,3,5-triazin-2-one?
1-tert-butyl-4-methylidene-3-propan-2-yl-1,3,5-triazin-2-one has a molecular weight of 209.29 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-methylidene-3-propan-2-yl-1,3,5-triazin-2-one is sourced from PubChem (CID 59802858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).