C33H43NO17 — CID 598030
[3,4-diacetyloxy-6-(4-methylanilino)-5-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 598030) has the molecular formula C33H43NO17 and a molecular weight of 725.70 g/mol. Its IUPAC name is [3,4-diacetyloxy-6-(4-methylanilino)-5-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-6-(4-methylanilino)-5-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 598030 |
| Molecular Formula | C33H43NO17 |
| Molecular Weight | 725.70 g/mol |
| Exact Mass | 725.25 |
| IUPAC Name | [3,4-diacetyloxy-6-(4-methylanilino)-5-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Nc2ccc(C)cc2)C(OC2OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C2OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C33H43NO17/c1-15-9-11-23(12-10-15)34-32-30(28(46-20(6)39)26(44-18(4)37)24(49-32)13-42-16(2)35)51-33-31(48-22(8)41)29(47-21(7)40)27(45-19(5)38)25(50-33)14-43-17(3)36/h9-12,24-34H,13-14H2,1-8H3 |
| InChIKey | MQUIEDBIZZKLOC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 223.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.70 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|