benzyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate

C18H23NO3 — CID 59803011

IUPACbenzyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate
SMILESO=C1CCC2(CC1)CCN(C(=O)OCc1ccccc1)CC2
InChIInChI=1S/C18H23NO3/c20-16-6-8-18(9-7-16)10-12-19(13-11-18)17(21)22-14-15-4-2-1-3-5-15/h1-5H,6-14H2
InChIKeyXWVRAUFBYDPEPY-UHFFFAOYSA-N
MW301.39 g/mol
LogP3.55
Rot. Bonds2

About benzyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate

benzyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate (PubChem CID 59803011) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is benzyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate.

Molecular Properties

Compound Namebenzyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate
PubChem CID59803011
Molecular FormulaC18H23NO3
Molecular Weight301.39 g/mol
Exact Mass301.17
IUPAC Namebenzyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate
SMILESO=C1CCC2(CC1)CCN(C(=O)OCc1ccccc1)CC2
InChIInChI=1S/C18H23NO3/c20-16-6-8-18(9-7-16)10-12-19(13-11-18)17(21)22-14-15-4-2-1-3-5-15/h1-5H,6-14H2
InChIKeyXWVRAUFBYDPEPY-UHFFFAOYSA-N
XLogP3.55
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.39
LogP ≤ 53.55
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate?
The IUPAC name of benzyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate (CID 59803011) is benzyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate.
What is the SMILES notation for benzyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate?
The canonical SMILES for benzyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate is O=C1CCC2(CC1)CCN(C(=O)OCc1ccccc1)CC2.
What is the InChIKey of benzyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate?
The InChIKey is XWVRAUFBYDPEPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO3/c20-16-6-8-18(9-7-16)10-12-19(13-11-18)17(21)22-14-15-4-2-1-3-5-15/h1-5H,6-14H2.
What are the key properties of benzyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate?
benzyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate has a molecular weight of 301.39 g/mol, XLogP of 3.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate is sourced from PubChem (CID 59803011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).