C21H25BrFNO3 — CID 59803154
tert-butyl N-[(3-bromo-4-methoxyphenyl)methyl]-N-[(1R)-1-(3-fluorophenyl)ethyl]carbamate (PubChem CID 59803154) has the molecular formula C21H25BrFNO3 and a molecular weight of 438.34 g/mol. Its IUPAC name is tert-butyl N-[(3-bromo-4-methoxyphenyl)methyl]-N-[(1R)-1-(3-fluorophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(3-bromo-4-methoxyphenyl)methyl]-N-[(1R)-1-(3-fluorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 59803154 |
| Molecular Formula | C21H25BrFNO3 |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | tert-butyl N-[(3-bromo-4-methoxyphenyl)methyl]-N-[(1R)-1-(3-fluorophenyl)ethyl]carbamate |
| SMILES | COc1ccc(CN(C(=O)OC(C)(C)C)[C@H](C)c2cccc(F)c2)cc1Br |
| InChI | InChI=1S/C21H25BrFNO3/c1-14(16-7-6-8-17(23)12-16)24(20(25)27-21(2,3)4)13-15-9-10-19(26-5)18(22)11-15/h6-12,14H,13H2,1-5H3/t14-/m1/s1 |
| InChIKey | COZRIRIUJMAMIN-CQSZACIVSA-N |
| XLogP | 6.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |