About 8-methylpyrido[4,3-c]pyridazine
8-methylpyrido[4,3-c]pyridazine (PubChem CID 59803302) has the molecular formula C8H7N3
and a molecular weight of 145.16 g/mol. Its IUPAC name is 8-methylpyrido[4,3-c]pyridazine.
Molecular Properties
| Compound Name | 8-methylpyrido[4,3-c]pyridazine |
| PubChem CID | 59803302 |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 8-methylpyrido[4,3-c]pyridazine |
| SMILES | Cc1cncc2ccnnc12 |
| InChI | InChI=1S/C8H7N3/c1-6-4-9-5-7-2-3-10-11-8(6)7/h2-5H,1H3 |
| InChIKey | ZJFBROMBJVHQQC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methylpyrido[4,3-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylpyrido[4,3-c]pyridazine?
The IUPAC name of 8-methylpyrido[4,3-c]pyridazine (CID 59803302) is 8-methylpyrido[4,3-c]pyridazine.
What is the SMILES notation for 8-methylpyrido[4,3-c]pyridazine?
The canonical SMILES for 8-methylpyrido[4,3-c]pyridazine is Cc1cncc2ccnnc12.
What is the InChIKey of 8-methylpyrido[4,3-c]pyridazine?
The InChIKey is ZJFBROMBJVHQQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3/c1-6-4-9-5-7-2-3-10-11-8(6)7/h2-5H,1H3.
What are the key properties of 8-methylpyrido[4,3-c]pyridazine?
8-methylpyrido[4,3-c]pyridazine has a molecular weight of 145.16 g/mol, XLogP of 1.33, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylpyrido[4,3-c]pyridazine is sourced from PubChem (CID 59803302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).