C20H23N — CID 59803359
(3aR,4S)-8-ethyl-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline (PubChem CID 59803359) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is (3aR,4S)-8-ethyl-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4S)-8-ethyl-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 59803359 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (3aR,4S)-8-ethyl-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline |
| SMILES | CCc1ccc2c(c1)C1CCC[C@H]1[C@@H](c1ccccc1)N2 |
| InChI | InChI=1S/C20H23N/c1-2-14-11-12-19-18(13-14)16-9-6-10-17(16)20(21-19)15-7-4-3-5-8-15/h3-5,7-8,11-13,16-17,20-21H,2,6,9-10H2,1H3/t16?,17-,20-/m1/s1 |
| InChIKey | PFNVVMMOEGGKLY-HMEKMZBJSA-N |
| XLogP | 5.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |