C23H17F6N3O4S — CID 59804153
(5Z)-5-[[4-[2,4-bis(trifluoromethyl)phenoxy]-3-methoxyphenyl]methylidene]-2-(3-oxopiperazin-1-yl)-1,3-thiazol-4-one (PubChem CID 59804153) has the molecular formula C23H17F6N3O4S and a molecular weight of 545.46 g/mol. Its IUPAC name is (5Z)-5-[[4-[2,4-bis(trifluoromethyl)phenoxy]-3-methoxyphenyl]methylidene]-2-(3-oxopiperazin-1-yl)-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[4-[2,4-bis(trifluoromethyl)phenoxy]-3-methoxyphenyl]methylidene]-2-(3-oxopiperazin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 59804153 |
| Molecular Formula | C23H17F6N3O4S |
| Molecular Weight | 545.46 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | (5Z)-5-[[4-[2,4-bis(trifluoromethyl)phenoxy]-3-methoxyphenyl]methylidene]-2-(3-oxopiperazin-1-yl)-1,3-thiazol-4-one |
| SMILES | COc1cc(/C=C2\SC(N3CCNC(=O)C3)=NC2=O)ccc1Oc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C23H17F6N3O4S/c1-35-17-8-12(9-18-20(34)31-21(37-18)32-7-6-30-19(33)11-32)2-4-16(17)36-15-5-3-13(22(24,25)26)10-14(15)23(27,28)29/h2-5,8-10H,6-7,11H2,1H3,(H,30,33)/b18-9- |
| InChIKey | CKUIKDHCECGKHI-NVMNQCDNSA-N |
| XLogP | 4.93 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|