C24H19F4N3O3S — CID 59804198
4-[4-[(Z)-[2-(2,6-dimethylmorpholin-4-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-2-fluorophenoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 59804198) has the molecular formula C24H19F4N3O3S and a molecular weight of 505.49 g/mol. Its IUPAC name is 4-[4-[(Z)-[2-(2,6-dimethylmorpholin-4-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-2-fluorophenoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[(Z)-[2-(2,6-dimethylmorpholin-4-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-2-fluorophenoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 59804198 |
| Molecular Formula | C24H19F4N3O3S |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 4-[4-[(Z)-[2-(2,6-dimethylmorpholin-4-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-2-fluorophenoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | CC1CN(C2=NC(=O)/C(=C/c3ccc(Oc4ccc(C#N)cc4C(F)(F)F)c(F)c3)S2)CC(C)O1 |
| InChI | InChI=1S/C24H19F4N3O3S/c1-13-11-31(12-14(2)33-13)23-30-22(32)21(35-23)9-15-3-6-20(18(25)8-15)34-19-5-4-16(10-29)7-17(19)24(26,27)28/h3-9,13-14H,11-12H2,1-2H3/b21-9- |
| InChIKey | WSETXGWWUKZWPK-NKVSQWTQSA-N |
| XLogP | 5.59 |
| TPSA | 74.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|