C13H14N2S — CID 59804251
4-[(1S)-1-methyl-2,3-dihydro-1H-inden-2-yl]-1,3-dihydroimidazole-2-thione (PubChem CID 59804251) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is 4-[(1S)-1-methyl-2,3-dihydro-1H-inden-2-yl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[(1S)-1-methyl-2,3-dihydro-1H-inden-2-yl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 59804251 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 4-[(1S)-1-methyl-2,3-dihydro-1H-inden-2-yl]-1,3-dihydroimidazole-2-thione |
| SMILES | C[C@@H]1c2ccccc2CC1c1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C13H14N2S/c1-8-10-5-3-2-4-9(10)6-11(8)12-7-14-13(16)15-12/h2-5,7-8,11H,6H2,1H3,(H2,14,15,16)/t8-,11?/m1/s1 |
| InChIKey | VRZWYPNQEVOAGP-RZZZFEHKSA-N |
| XLogP | 3.52 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|