C28H18F3N5O2 — CID 59804339
(3Z)-3-(1H-pyrrol-2-ylmethylidene)-6-[3-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]anilino]-1H-indol-2-one (PubChem CID 59804339) has the molecular formula C28H18F3N5O2 and a molecular weight of 513.48 g/mol. Its IUPAC name is (3Z)-3-(1H-pyrrol-2-ylmethylidene)-6-[3-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]anilino]-1H-indol-2-one.
| Compound Name | (3Z)-3-(1H-pyrrol-2-ylmethylidene)-6-[3-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]anilino]-1H-indol-2-one |
|---|---|
| PubChem CID | 59804339 |
| Molecular Formula | C28H18F3N5O2 |
| Molecular Weight | 513.48 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | (3Z)-3-(1H-pyrrol-2-ylmethylidene)-6-[3-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]anilino]-1H-indol-2-one |
| SMILES | O=C1Nc2cc(Nc3cccc(-c4nc(-c5cccc(C(F)(F)F)c5)no4)c3)ccc2/C1=C/c1ccc[nH]1 |
| InChI | InChI=1S/C28H18F3N5O2/c29-28(30,31)18-6-1-4-16(12-18)25-35-27(38-36-25)17-5-2-7-20(13-17)33-21-9-10-22-23(14-19-8-3-11-32-19)26(37)34-24(22)15-21/h1-15,32-33H,(H,34,37)/b23-14- |
| InChIKey | ALGQTDPDXZPJEQ-UCQKPKSFSA-N |
| XLogP | 6.99 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.48 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|