C24H40O5 — CID 59804774
3-[(2R,4R,7R,9R,14R)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyl-3-oxo-4-tricyclo[5.4.3.01,8]tetradecanyl]propanal (PubChem CID 59804774) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is 3-[(2R,4R,7R,9R,14R)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyl-3-oxo-4-tricyclo[5.4.3.01,8]tetradecanyl]propanal.
| Compound Name | 3-[(2R,4R,7R,9R,14R)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyl-3-oxo-4-tricyclo[5.4.3.01,8]tetradecanyl]propanal |
|---|---|
| PubChem CID | 59804774 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 3-[(2R,4R,7R,9R,14R)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyl-3-oxo-4-tricyclo[5.4.3.01,8]tetradecanyl]propanal |
| SMILES | COCOC1C[C@@](C)(CCC=O)C(=O)[C@H](C)C23CCC(OC)C2[C@@]1(C)[C@H](C)CC3 |
| InChI | InChI=1S/C24H40O5/c1-16-8-11-24-12-9-18(28-6)20(24)23(16,4)19(29-15-27-5)14-22(3,10-7-13-25)21(26)17(24)2/h13,16-20H,7-12,14-15H2,1-6H3/t16-,17+,18?,19?,20?,22-,23+,24?/m1/s1 |
| InChIKey | BWEIOFNYWJOVLT-ZMIXFNHUSA-N |
| XLogP | 4.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|