C29H47FN2O5 — CID 59804818
[(2R,3S,4S,6R,7R,14R)-4-(2-fluoroethyl)-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-[(3R,4S)-1,4-dimethylpiperidine-3-carbonyl]carbamate (PubChem CID 59804818) has the molecular formula C29H47FN2O5 and a molecular weight of 522.70 g/mol. Its IUPAC name is [(2R,3S,4S,6R,7R,14R)-4-(2-fluoroethyl)-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-[(3R,4S)-1,4-dimethylpiperidine-3-carbonyl]carbamate.
| Compound Name | [(2R,3S,4S,6R,7R,14R)-4-(2-fluoroethyl)-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-[(3R,4S)-1,4-dimethylpiperidine-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 59804818 |
| Molecular Formula | C29H47FN2O5 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | [(2R,3S,4S,6R,7R,14R)-4-(2-fluoroethyl)-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-[(3R,4S)-1,4-dimethylpiperidine-3-carbonyl]carbamate |
| SMILES | C[C@@H]1CCC23CCC(=O)C2[C@]1(C)[C@H](OC(=O)NC(=O)[C@H]1CN(C)CC[C@@H]1C)C[C@@](C)(CCF)[C@@H](O)[C@@H]3C |
| InChI | InChI=1S/C29H47FN2O5/c1-17-9-14-32(6)16-20(17)25(35)31-26(36)37-22-15-27(4,12-13-30)24(34)19(3)29-10-7-18(2)28(22,5)23(29)21(33)8-11-29/h17-20,22-24,34H,7-16H2,1-6H3,(H,31,35,36)/t17-,18+,19-,20-,22+,23?,24-,27+,28-,29?/m0/s1 |
| InChIKey | OACKFUZRVVASAL-MSIBTIBMSA-N |
| XLogP | 4.36 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |